1-Piperidineethanamine, N-(2-chloro-4-fluorophenyl)-
CAS No: 823189-89-5
Piperidine
823189-89-5
piperidineethanamine,chloro,fluorophenyl,piperidine,823189-89-5
2025-10-20 Discover 1-Piperidineethanamine, N-(2-chloro-4-fluorophenyl)- (CAS No: 823189-89-5) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.