| 222987-60-2 |
Cyclohexanecarboxylic acid, 4-(4-pyridinyl)- |
2040971 |
| 645407-60-9 |
Cyclohexanecarboxamide,N-3-quinolinyl-1-[[4-(trifluoromethyl)phenyl]methyl]- |
2041146 |
| 850887-60-4 |
Cyclohexanecarboxylic acid,4-[[(1,1-dimethylethoxy)carbonyl]amino]-1-(3-methoxyphenyl)-, cis- |
2041256 |
| 871728-60-8 |
Cyclohexanemethanol, 4-[2-(trifluoromethyl)-1H-benzimidazol-1-yl]-,methanesulfonate (ester) |
2041349 |
| 26497-60-9 |
Cyclohexanecarboxylic acid, 2-(phenylhydrazono)-, ethyl ester |
2043633 |
| 663215-60-9 |
Cyclohexanecarboxylic acid, 4-[(1H-purin-6-ylamino)methyl]- |
2043692 |
| 18397-60-9 |
Hexanenitrile, 2-methyl-5-oxo- |
2049170 |
| 203247-60-3 |
Hexanedioic acid, 2-[[(4-methoxyphenyl)sulfonyl]methyl]-, 6-methyl ester |
2094716 |
| 90411-60-2 |
Hexanedioic acid, reaction products with acetic acid and diethylenetriamine |
2119616 |
| 111887-60-6 |
3-hydroxy-3-Azabicyclo[3.1.0]hexane |
2156153 |
| 136682-60-5 |
Cyclohexanecarboxylic acid,2-[(4,6-dimethoxy-2-pyrimidinyl)oxy]-5-(1,1-dimethylethyl)- |
2156421 |
| 168891-60-9 |
Cyclohexanecarboxylic acid,4-[[4-[(4-piperidinylcarbonyl)amino]benzoyl]amino]-, methyl ester,trans-, mono(trifluoroacetate) |
2157817 |
| 874097-60-6 |
Cyclohexanecarboxamide,4-ethyl-4-methyl-2,6-dioxo-N-[4-(trifluoromethyl)phenyl]- |
2173702 |
| 26047-60-9 |
3,4-Hexanedione, 2,5-dihydroxy- |
2175300 |
| 1022879-60-2 |
2-(((4-(Trifluoromethoxy)phenyl)amino)methylene)cyclohexane-1,3-dione |
2177966 |
| 446044-60-6 |
Cyclohexanecarboxylic acid,2-(1,3-dihydro-1,3-dioxo-2H-naphth[2,3-f]isoindol-2-yl)-,(6S)-6-methyloctyl ester, (1R,2R)- |
2182729 |
| 138112-60-4 |
Spiro[cyclohexane-1,9'-[9H]fluoren]-2-one, 4'-nitro- |
2188553 |
| 1202043-60-4 |
2-methyl-2-propanyl 2-benzyl-3-azabicyclo[3.1.0]hexane-3-carboxyl Ate |
2194537 |
| 730-60-7 |
2,5-DIMETHYL-1-HYDROXYHEXANE |
2197219 |
| 589489-60-1 |
1,4-Cyclohexanediamine, N-(7-chloro-4-quinolinyl)-N'-4-quinolinyl-, cis- |
2202426 |
| 2043-60-1 |
Cyclohexanecarboxyaldehyde |
2205072 |
| 88233-60-7 |
1H-Azepinium,1,1'-[2,5-bis(4-propoxybenzoyl)-1,6-hexanediyl]bis[hexahydro-1-methyl-,diiodide (9CI) |
2234199 |
| 137768-60-6 |
Cyclohexanecarboselenoic acid, O-[(1,1-dimethylethyl)dimethylsilyl]ester |
2262598 |
| 659726-60-0 |
1,4-Hexanediol, 6-[(heptadecafluorooctyl)oxy]-, bis(hydrogen sulfate),disodium salt |
2268104 |
| 138007-60-0 |
Cyclohexanecarboxylic acid, 4-[(6-methylheptyl)oxy]-,2,3-dicyano-4-hydroxyphenyl ester, trans- |
2286339 |
| 63953-60-6 |
Spiro[2H-benzimidazole-2,1'-cyclohexane],5,6-bis(4-methyl-1-piperazinyl)- |
2298938 |
| 902132-60-9 |
Hexanedioic acid, 2-phenyl-, 1-ethyl ester, 6-hydrazide |
2305299 |
| 139388-60-6 |
Methanimidamide,N',N'''-[(2-oxo-1,3-cyclohexanediylidene)dimethylidyne]bis[N,N-dimethyl- |
2306701 |
| 873781-60-3 |
Cyclohexanecarboxamide,4-amino-N-[3-[4-[3-(hydroxymethyl)phenyl]-6-(4-morpholinyl)-2-pyrimidinyl]phenyl]- |
2334020 |
| 83859-60-3 |
1,6-Hexanediol, 1,6-diphenyl- |
2349065 |
| 197632-60-3 |
Hexanediamide, N,N'-bis(8-oxobicyclo[4.2.0]octa-1,3,5-trien-3-yl)- |
2350859 |
| 81397-60-6 |
hexanedioic acid, bis(2,3-diazidopropyl) ester |
2399779 |
| 16839-60-4 |
2-[(2-methyloxiran-2-yl)methyl]-6-oxabicyclo[3.1.0]hexane |
2415021 |
| 876767-60-1 |
Cyclohexanecarboxamide,N-[2-[2-amino-6-(5-pyrimidinyl)-3(4H)-quinazolinyl]ethyl]- |
2421832 |
| 133729-60-9 |
Cyclohexane, 1,2-diethylidene-, (E,Z)- |
2428159 |
| 872682-60-5 |
Cyclohexanepropanoic acid,a-[(5-methyl-3-pyridinyl)methylene]-b-oxo-, ethyl ester |
2430252 |